Cytosporone B
Catalog No: 16122924
CAS Number: 321661-62-5
Purity: 98%
Cytosporone B is the first naturally occurring agonist for nuclear orphan receptor Nur77. The molecule binds with high affinity (IC50=0.278 nM) to the ligand-binding domain of Nur77 and stimulates Nur77-dependent activities. Nur77 is also involved in glucose homeostasis, where it induces genes involved in gluconeogenesis. Csn-B physically binds to Nur77 and activates its transactivational activity and translocation to mitochondria to induce apoptosis. It inhibits cancer cell proliferation and tumor growth.
For research use only. We do not sell to patients.
Chemical Information
| Name | Cytosporone B |
|---|---|
| Iupac Chemical Name | Cytosporone B |
| Synonyms | N/A |
| Molecular Formula | C18H26O5 |
| Molecular Weight | 322.4 |
| Smile | CCCCCCCC(=O)c1c(cc(cc1O)O)CC(=O)OCC |
| InChiKey | UVVWQQKSNZLUQA-UHFFFAOYSA-N |
| InChi | InChI=1S/C18H26O5/c1-3-5-6-7-8-9-15(20)18-13(11-17(22)23-4-2)10-14(19)12-16(18)21/h10,12,19,21H,3-9,11H2,1-2H3 |
| CAS Number | 321661-62-5 |
| MDL | MFCD12912406 |
| Related CAS |
Ordering Information
| Packaging | Price | Availability | Purity | Shipping Time |
|---|---|---|---|---|
| Bulk | Enquiry | Enquiry | Enquiry |
| Formulation | crystalline solid |
|---|---|
| Purity | 98% |
| Storage | 3 years -20ºCpowder |
| Solubility | Soluble in DMSO |
| Handling | |
| Shipping Condition | Shipped under ambient temperature as non-hazardous chemical. |
| HS Code |
Coming soon.
| Targets | |
|---|---|
| Mechanism | |
| Cell study | |
| Animal study | |
| Clinical study |
Not available
Chemical Structure
