Products
| Catalog No | Chemical Name | CAS Number | Purity | Chemical Structure |
|---|---|---|---|---|
| 52559 | Purvalanol B | 212844-54-7 | 98% |  |
| Purvalanol B(NG-95) is a cyclin-dependent kinase inhibitor with IC50 values of 6, 6, | ||||
| 52552 | Pracinostat | 929016-96-6 | 98% |  |
| Pracinostat(SB939) is a potent pan-HDAC inhibitor with IC50 of 40-140 nM with excepti | ||||
| 52519 | Purmorphamine | 483367-10-8 | 98% |  |
| Purmorphamine, which directly binds and activates Smoothened, blocks BODIPY-cyclopami | ||||
| 52513 | PD 169316 | 152121-53-4 | 98% |  |
| PD 169316 is a potent, cell-permeable and selective p38 MAP kinase inhibitor (IC50 = | ||||
| 52223 | PD153035 | 153436-54-5 | 98% |  |
| PD153035(ZM 252868; AG 1517) is a potent and specific inhibitor of EGFR with Ki and I | ||||
| 52233 | PPQ-102 | 931706-15-9 | 98% |  |
| PPQ-102 is a potent CFTR inhibitor which can completely inhibited CFTR chloride curre | ||||
| 52231 | PTC124c | 775304-57-9 | 98% |  |
| PTC124 (Ataluren) selectively induces ribosomal read-through of premature but not nor | ||||
| 52227 | PR-619 | 2645-32-1 | 98% |  |
| PR-619 is a broad-range DUB inhibitor with potential for further development as a che | ||||
| 52113 | PFI-2 | 1627676-59-8 | 98% |  |
| PFI-2 is a potent, selective, and cell-activelysine methyltransferase SETD7inhibitor | ||||
| 52107 | Ponatinib (AP24534) | 943319-70-8 | 98% | -cas-943319-70-8.png) |
| Ponatinib (AP24534) is a novel, potent multi-target inhibitor ofAbl, PDGFR, VEGFR2, F | ||||
| 52001 | Palbociclib | 571190-30-2 | ≧98.0% |  |
| Palbociclib (PD-0332991) is an orally available pyridopyrimidine-derived cyclin-depen | ||||
| 52011 | Palbociclib(PD-0332991)HCl | 827022-32-2 | >98% by HPLC | HCl-cas-827022-32-2.png) |
| Palbociclib (PD-0332991) HCl is a highly selective inhibitor ofCDK4/6withIC50of 11 nM | ||||
| 52012 | Palbociclib (PD0332991) Isethionate | 827022-33-3 | 98% | Isethionate-cas-827022-33-3.png) |
| Palbociclib (PD0332991) Isethionate is a highly selective inhibitor ofCDK4/6withIC50o | ||||
| 51701 | PF-06463922 | 1454846-35-5 | 98% |  |
| PF-06463922 is an orally available, ATP-competitive inhibitor of the receptor tyrosin | ||||